C25H31ClN2O5 — CID 42343832
ethyl (3S)-1-[2-[(3R)-3-(2-chlorophenyl)-1-cyclopentyl-2,5-dioxopyrrolidin-3-yl]acetyl]piperidine-3-carboxylate (PubChem CID 42343832) has the molecular formula C25H31ClN2O5 and a molecular weight of 474.99 g/mol. Its IUPAC name is ethyl (3S)-1-[2-[(3R)-3-(2-chlorophenyl)-1-cyclopentyl-2,5-dioxopyrrolidin-3-yl]acetyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-[2-[(3R)-3-(2-chlorophenyl)-1-cyclopentyl-2,5-dioxopyrrolidin-3-yl]acetyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 42343832 |
| Molecular Formula | C25H31ClN2O5 |
| Molecular Weight | 474.99 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | ethyl (3S)-1-[2-[(3R)-3-(2-chlorophenyl)-1-cyclopentyl-2,5-dioxopyrrolidin-3-yl]acetyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN(C(=O)C[C@]2(c3ccccc3Cl)CC(=O)N(C3CCCC3)C2=O)C1 |
| InChI | InChI=1S/C25H31ClN2O5/c1-2-33-23(31)17-8-7-13-27(16-17)21(29)14-25(19-11-5-6-12-20(19)26)15-22(30)28(24(25)32)18-9-3-4-10-18/h5-6,11-12,17-18H,2-4,7-10,13-16H2,1H3/t17-,25+/m0/s1 |
| InChIKey | QFMQJGRHRGHEFA-SSOJOUAXSA-N |
| XLogP | 3.47 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.99 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|