C26H33FN2O5 — CID 42382945
ethyl 2-[(2S)-1-[2-[(3S)-1-cyclopentyl-3-(3-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]acetyl]piperidin-2-yl]acetate (PubChem CID 42382945) has the molecular formula C26H33FN2O5 and a molecular weight of 472.56 g/mol. Its IUPAC name is ethyl 2-[(2S)-1-[2-[(3S)-1-cyclopentyl-3-(3-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]acetyl]piperidin-2-yl]acetate.
| Compound Name | ethyl 2-[(2S)-1-[2-[(3S)-1-cyclopentyl-3-(3-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]acetyl]piperidin-2-yl]acetate |
|---|---|
| PubChem CID | 42382945 |
| Molecular Formula | C26H33FN2O5 |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | ethyl 2-[(2S)-1-[2-[(3S)-1-cyclopentyl-3-(3-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]acetyl]piperidin-2-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1CCCCN1C(=O)C[C@@]1(c2cccc(F)c2)CC(=O)N(C2CCCC2)C1=O |
| InChI | InChI=1S/C26H33FN2O5/c1-2-34-24(32)15-21-12-5-6-13-28(21)22(30)16-26(18-8-7-9-19(27)14-18)17-23(31)29(25(26)33)20-10-3-4-11-20/h7-9,14,20-21H,2-6,10-13,15-17H2,1H3/t21-,26-/m0/s1 |
| InChIKey | SBGTXAHTXYYJGN-LVXARBLLSA-N |
| XLogP | 3.49 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|