C22H27FN2O5 — CID 25327742
ethyl 2-[(2R)-1-[2-[(3R)-3-(3-fluorophenyl)-1-methyl-2,5-dioxopyrrolidin-3-yl]acetyl]piperidin-2-yl]acetate (PubChem CID 25327742) has the molecular formula C22H27FN2O5 and a molecular weight of 418.47 g/mol. Its IUPAC name is ethyl 2-[(2R)-1-[2-[(3R)-3-(3-fluorophenyl)-1-methyl-2,5-dioxopyrrolidin-3-yl]acetyl]piperidin-2-yl]acetate.
| Compound Name | ethyl 2-[(2R)-1-[2-[(3R)-3-(3-fluorophenyl)-1-methyl-2,5-dioxopyrrolidin-3-yl]acetyl]piperidin-2-yl]acetate |
|---|---|
| PubChem CID | 25327742 |
| Molecular Formula | C22H27FN2O5 |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | ethyl 2-[(2R)-1-[2-[(3R)-3-(3-fluorophenyl)-1-methyl-2,5-dioxopyrrolidin-3-yl]acetyl]piperidin-2-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1CCCCN1C(=O)C[C@]1(c2cccc(F)c2)CC(=O)N(C)C1=O |
| InChI | InChI=1S/C22H27FN2O5/c1-3-30-20(28)12-17-9-4-5-10-25(17)19(27)14-22(13-18(26)24(2)21(22)29)15-7-6-8-16(23)11-15/h6-8,11,17H,3-5,9-10,12-14H2,1-2H3/t17-,22+/m1/s1 |
| InChIKey | BGPWLEYHULYOAP-VGSWGCGISA-N |
| XLogP | 2.18 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|