C17H18FNO4 — CID 118760214
2-[1-cyclopentyl-3-(3-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]acetic acid (PubChem CID 118760214) has the molecular formula C17H18FNO4 and a molecular weight of 319.33 g/mol. Its IUPAC name is 2-[1-cyclopentyl-3-(3-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]acetic acid.
| Compound Name | 2-[1-cyclopentyl-3-(3-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 118760214 |
| Molecular Formula | C17H18FNO4 |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 2-[1-cyclopentyl-3-(3-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]acetic acid |
| SMILES | O=C(O)CC1(c2cccc(F)c2)CC(=O)N(C2CCCC2)C1=O |
| InChI | InChI=1S/C17H18FNO4/c18-12-5-3-4-11(8-12)17(10-15(21)22)9-14(20)19(16(17)23)13-6-1-2-7-13/h3-5,8,13H,1-2,6-7,9-10H2,(H,21,22) |
| InChIKey | YYMLVWKPERXYEX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|