C25H24FN5O3 — CID 42192717
(3S)-3-(3-fluorophenyl)-1-methyl-3-[2-oxo-2-(4-quinazolin-4-ylpiperazin-1-yl)ethyl]pyrrolidine-2,5-dione (PubChem CID 42192717) has the molecular formula C25H24FN5O3 and a molecular weight of 461.50 g/mol. Its IUPAC name is (3S)-3-(3-fluorophenyl)-1-methyl-3-[2-oxo-2-(4-quinazolin-4-ylpiperazin-1-yl)ethyl]pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-(3-fluorophenyl)-1-methyl-3-[2-oxo-2-(4-quinazolin-4-ylpiperazin-1-yl)ethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 42192717 |
| Molecular Formula | C25H24FN5O3 |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | (3S)-3-(3-fluorophenyl)-1-methyl-3-[2-oxo-2-(4-quinazolin-4-ylpiperazin-1-yl)ethyl]pyrrolidine-2,5-dione |
| SMILES | CN1C(=O)C[C@@](CC(=O)N2CCN(c3ncnc4ccccc34)CC2)(c2cccc(F)c2)C1=O |
| InChI | InChI=1S/C25H24FN5O3/c1-29-21(32)14-25(24(29)34,17-5-4-6-18(26)13-17)15-22(33)30-9-11-31(12-10-30)23-19-7-2-3-8-20(19)27-16-28-23/h2-8,13,16H,9-12,14-15H2,1H3/t25-/m1/s1 |
| InChIKey | KKAXEHFEPCNSHK-RUZDIDTESA-N |
| XLogP | 2.13 |
| TPSA | 86.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|