C23H25FN4O3 — CID 126465429
3-(3-fluorophenyl)-3-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-1-(pyridin-3-ylmethyl)pyrrolidine-2,5-dione (PubChem CID 126465429) has the molecular formula C23H25FN4O3 and a molecular weight of 424.48 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-3-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-1-(pyridin-3-ylmethyl)pyrrolidine-2,5-dione.
| Compound Name | 3-(3-fluorophenyl)-3-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-1-(pyridin-3-ylmethyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 126465429 |
| Molecular Formula | C23H25FN4O3 |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 3-(3-fluorophenyl)-3-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-1-(pyridin-3-ylmethyl)pyrrolidine-2,5-dione |
| SMILES | CN1CCN(C(=O)CC2(c3cccc(F)c3)CC(=O)N(Cc3cccnc3)C2=O)CC1 |
| InChI | InChI=1S/C23H25FN4O3/c1-26-8-10-27(11-9-26)20(29)13-23(18-5-2-6-19(24)12-18)14-21(30)28(22(23)31)16-17-4-3-7-25-15-17/h2-7,12,15H,8-11,13-14,16H2,1H3 |
| InChIKey | GGMIDFPUKIIMMQ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|