C27H26FN3O3 — CID 45211853
2-[3-(3-fluorophenyl)-2,5-dioxo-1-(pyridin-3-ylmethyl)pyrrolidin-3-yl]-N-methyl-N-(2-phenylethyl)acetamide (PubChem CID 45211853) has the molecular formula C27H26FN3O3 and a molecular weight of 459.52 g/mol. Its IUPAC name is 2-[3-(3-fluorophenyl)-2,5-dioxo-1-(pyridin-3-ylmethyl)pyrrolidin-3-yl]-N-methyl-N-(2-phenylethyl)acetamide.
| Compound Name | 2-[3-(3-fluorophenyl)-2,5-dioxo-1-(pyridin-3-ylmethyl)pyrrolidin-3-yl]-N-methyl-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 45211853 |
| Molecular Formula | C27H26FN3O3 |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 2-[3-(3-fluorophenyl)-2,5-dioxo-1-(pyridin-3-ylmethyl)pyrrolidin-3-yl]-N-methyl-N-(2-phenylethyl)acetamide |
| SMILES | CN(CCc1ccccc1)C(=O)CC1(c2cccc(F)c2)CC(=O)N(Cc2cccnc2)C1=O |
| InChI | InChI=1S/C27H26FN3O3/c1-30(14-12-20-7-3-2-4-8-20)24(32)16-27(22-10-5-11-23(28)15-22)17-25(33)31(26(27)34)19-21-9-6-13-29-18-21/h2-11,13,15,18H,12,14,16-17,19H2,1H3 |
| InChIKey | WBSXXUSHBXVDLY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|