C26H26N2O3S — CID 45181207
2-[2,5-dioxo-3-phenyl-1-(thiophen-2-ylmethyl)pyrrolidin-3-yl]-N-methyl-N-(2-phenylethyl)acetamide (PubChem CID 45181207) has the molecular formula C26H26N2O3S and a molecular weight of 446.57 g/mol. Its IUPAC name is 2-[2,5-dioxo-3-phenyl-1-(thiophen-2-ylmethyl)pyrrolidin-3-yl]-N-methyl-N-(2-phenylethyl)acetamide.
| Compound Name | 2-[2,5-dioxo-3-phenyl-1-(thiophen-2-ylmethyl)pyrrolidin-3-yl]-N-methyl-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 45181207 |
| Molecular Formula | C26H26N2O3S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 2-[2,5-dioxo-3-phenyl-1-(thiophen-2-ylmethyl)pyrrolidin-3-yl]-N-methyl-N-(2-phenylethyl)acetamide |
| SMILES | CN(CCc1ccccc1)C(=O)CC1(c2ccccc2)CC(=O)N(Cc2cccs2)C1=O |
| InChI | InChI=1S/C26H26N2O3S/c1-27(15-14-20-9-4-2-5-10-20)23(29)17-26(21-11-6-3-7-12-21)18-24(30)28(25(26)31)19-22-13-8-16-32-22/h2-13,16H,14-15,17-19H2,1H3 |
| InChIKey | WDOGAWSGPVIXHD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|