C27H27N3O3 — CID 45168626
N-benzyl-N-methyl-2-[3-(2-methylphenyl)-2,5-dioxo-1-(pyridin-3-ylmethyl)pyrrolidin-3-yl]acetamide (PubChem CID 45168626) has the molecular formula C27H27N3O3 and a molecular weight of 441.53 g/mol. Its IUPAC name is N-benzyl-N-methyl-2-[3-(2-methylphenyl)-2,5-dioxo-1-(pyridin-3-ylmethyl)pyrrolidin-3-yl]acetamide.
| Compound Name | N-benzyl-N-methyl-2-[3-(2-methylphenyl)-2,5-dioxo-1-(pyridin-3-ylmethyl)pyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 45168626 |
| Molecular Formula | C27H27N3O3 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | N-benzyl-N-methyl-2-[3-(2-methylphenyl)-2,5-dioxo-1-(pyridin-3-ylmethyl)pyrrolidin-3-yl]acetamide |
| SMILES | Cc1ccccc1C1(CC(=O)N(C)Cc2ccccc2)CC(=O)N(Cc2cccnc2)C1=O |
| InChI | InChI=1S/C27H27N3O3/c1-20-9-6-7-13-23(20)27(15-24(31)29(2)18-21-10-4-3-5-11-21)16-25(32)30(26(27)33)19-22-12-8-14-28-17-22/h3-14,17H,15-16,18-19H2,1-2H3 |
| InChIKey | VDKDQTGKDDQPQT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|