C30H34N4O3 — CID 45174306
2-[1-benzyl-3-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-N-methylacetamide (PubChem CID 45174306) has the molecular formula C30H34N4O3 and a molecular weight of 498.63 g/mol. Its IUPAC name is 2-[1-benzyl-3-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-N-methylacetamide.
| Compound Name | 2-[1-benzyl-3-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-N-methylacetamide |
|---|---|
| PubChem CID | 45174306 |
| Molecular Formula | C30H34N4O3 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | 2-[1-benzyl-3-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-N-methylacetamide |
| SMILES | Cc1ccccc1C1(CC(=O)N(C)Cc2n[nH]c3c2CCCCC3)CC(=O)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C30H34N4O3/c1-21-11-9-10-15-24(21)30(18-28(36)34(29(30)37)19-22-12-5-3-6-13-22)17-27(35)33(2)20-26-23-14-7-4-8-16-25(23)31-32-26/h3,5-6,9-13,15H,4,7-8,14,16-20H2,1-2H3,(H,31,32) |
| InChIKey | WFCAADXCIXJWBA-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|