C31H33N3O3 — CID 42436680
(3R)-3-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-3-(2-methylphenyl)-1-(pyridin-3-ylmethyl)pyrrolidine-2,5-dione (PubChem CID 42436680) has the molecular formula C31H33N3O3 and a molecular weight of 495.62 g/mol. Its IUPAC name is (3R)-3-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-3-(2-methylphenyl)-1-(pyridin-3-ylmethyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-3-(2-methylphenyl)-1-(pyridin-3-ylmethyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 42436680 |
| Molecular Formula | C31H33N3O3 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | (3R)-3-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-3-(2-methylphenyl)-1-(pyridin-3-ylmethyl)pyrrolidine-2,5-dione |
| SMILES | Cc1ccccc1[C@@]1(CC(=O)N2CCC(Cc3ccccc3)CC2)CC(=O)N(Cc2cccnc2)C1=O |
| InChI | InChI=1S/C31H33N3O3/c1-23-8-5-6-12-27(23)31(20-29(36)34(30(31)37)22-26-11-7-15-32-21-26)19-28(35)33-16-13-25(14-17-33)18-24-9-3-2-4-10-24/h2-12,15,21,25H,13-14,16-20,22H2,1H3/t31-/m1/s1 |
| InChIKey | LCRIHYXDHBXPHE-WJOKGBTCSA-N |
| XLogP | 4.46 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|