C20H19FN4O2 — CID 56902186
2-(3-fluoro-4-hydroxyphenyl)-1-(4-quinazolin-4-ylpiperazin-1-yl)ethanone (PubChem CID 56902186) has the molecular formula C20H19FN4O2 and a molecular weight of 366.40 g/mol. Its IUPAC name is 2-(3-fluoro-4-hydroxyphenyl)-1-(4-quinazolin-4-ylpiperazin-1-yl)ethanone.
| Compound Name | 2-(3-fluoro-4-hydroxyphenyl)-1-(4-quinazolin-4-ylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 56902186 |
| Molecular Formula | C20H19FN4O2 |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 2-(3-fluoro-4-hydroxyphenyl)-1-(4-quinazolin-4-ylpiperazin-1-yl)ethanone |
| SMILES | O=C(Cc1ccc(O)c(F)c1)N1CCN(c2ncnc3ccccc23)CC1 |
| InChI | InChI=1S/C20H19FN4O2/c21-16-11-14(5-6-18(16)26)12-19(27)24-7-9-25(10-8-24)20-15-3-1-2-4-17(15)22-13-23-20/h1-6,11,13,26H,7-10,12H2 |
| InChIKey | NRILBLJHROXGOZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |