C21H20FN3O — CID 110711471
2-(3-fluorophenyl)-1-(4-isoquinolin-1-ylpiperazin-1-yl)ethanone (PubChem CID 110711471) has the molecular formula C21H20FN3O and a molecular weight of 349.41 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-1-(4-isoquinolin-1-ylpiperazin-1-yl)ethanone.
| Compound Name | 2-(3-fluorophenyl)-1-(4-isoquinolin-1-ylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 110711471 |
| Molecular Formula | C21H20FN3O |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 2-(3-fluorophenyl)-1-(4-isoquinolin-1-ylpiperazin-1-yl)ethanone |
| SMILES | O=C(Cc1cccc(F)c1)N1CCN(c2nccc3ccccc23)CC1 |
| InChI | InChI=1S/C21H20FN3O/c22-18-6-3-4-16(14-18)15-20(26)24-10-12-25(13-11-24)21-19-7-2-1-5-17(19)8-9-23-21/h1-9,14H,10-13,15H2 |
| InChIKey | BSCBVQFSINZXQT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |