C15H19FN2O4 — CID 70728293
methyl N-[2-[4-(3-fluorophenoxy)piperidin-1-yl]-2-oxoethyl]carbamate (PubChem CID 70728293) has the molecular formula C15H19FN2O4 and a molecular weight of 310.32 g/mol. Its IUPAC name is methyl N-[2-[4-(3-fluorophenoxy)piperidin-1-yl]-2-oxoethyl]carbamate.
| Compound Name | methyl N-[2-[4-(3-fluorophenoxy)piperidin-1-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 70728293 |
| Molecular Formula | C15H19FN2O4 |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | methyl N-[2-[4-(3-fluorophenoxy)piperidin-1-yl]-2-oxoethyl]carbamate |
| SMILES | COC(=O)NCC(=O)N1CCC(Oc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C15H19FN2O4/c1-21-15(20)17-10-14(19)18-7-5-12(6-8-18)22-13-4-2-3-11(16)9-13/h2-4,9,12H,5-8,10H2,1H3,(H,17,20) |
| InChIKey | XYFYCJJSPWDUJC-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |