C16H22FNO3 — CID 68837389
2-methylpropyl 4-(3-fluorophenoxy)piperidine-1-carboxylate (PubChem CID 68837389) has the molecular formula C16H22FNO3 and a molecular weight of 295.35 g/mol. Its IUPAC name is 2-methylpropyl 4-(3-fluorophenoxy)piperidine-1-carboxylate.
| Compound Name | 2-methylpropyl 4-(3-fluorophenoxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 68837389 |
| Molecular Formula | C16H22FNO3 |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 2-methylpropyl 4-(3-fluorophenoxy)piperidine-1-carboxylate |
| SMILES | CC(C)COC(=O)N1CCC(Oc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C16H22FNO3/c1-12(2)11-20-16(19)18-8-6-14(7-9-18)21-15-5-3-4-13(17)10-15/h3-5,10,12,14H,6-9,11H2,1-2H3 |
| InChIKey | GKAPKNCPBMCSHF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |