C18H24N2O3 — CID 68843107
2-methylpropyl 4-(1H-indol-4-yloxy)piperidine-1-carboxylate (PubChem CID 68843107) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is 2-methylpropyl 4-(1H-indol-4-yloxy)piperidine-1-carboxylate.
| Compound Name | 2-methylpropyl 4-(1H-indol-4-yloxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 68843107 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 2-methylpropyl 4-(1H-indol-4-yloxy)piperidine-1-carboxylate |
| SMILES | CC(C)COC(=O)N1CCC(Oc2cccc3[nH]ccc23)CC1 |
| InChI | InChI=1S/C18H24N2O3/c1-13(2)12-22-18(21)20-10-7-14(8-11-20)23-17-5-3-4-16-15(17)6-9-19-16/h3-6,9,13-14,19H,7-8,10-12H2,1-2H3 |
| InChIKey | XEGPKKDUGYIOBP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |