C15H20N4O2S — CID 119069776
N-[2-(6-methoxy-1H-benzimidazol-2-yl)ethyl]thiomorpholine-4-carboxamide (PubChem CID 119069776) has the molecular formula C15H20N4O2S and a molecular weight of 320.42 g/mol. Its IUPAC name is N-[2-(6-methoxy-1H-benzimidazol-2-yl)ethyl]thiomorpholine-4-carboxamide.
| Compound Name | N-[2-(6-methoxy-1H-benzimidazol-2-yl)ethyl]thiomorpholine-4-carboxamide |
|---|---|
| PubChem CID | 119069776 |
| Molecular Formula | C15H20N4O2S |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | N-[2-(6-methoxy-1H-benzimidazol-2-yl)ethyl]thiomorpholine-4-carboxamide |
| SMILES | COc1ccc2nc(CCNC(=O)N3CCSCC3)[nH]c2c1 |
| InChI | InChI=1S/C15H20N4O2S/c1-21-11-2-3-12-13(10-11)18-14(17-12)4-5-16-15(20)19-6-8-22-9-7-19/h2-3,10H,4-9H2,1H3,(H,16,20)(H,17,18) |
| InChIKey | KQVSUTSHJZWGIA-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |