C22H24N4O2 — CID 46975099
N-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-5-methoxy-3-methyl-1H-indole-2-carboxamide (PubChem CID 46975099) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is N-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-5-methoxy-3-methyl-1H-indole-2-carboxamide.
| Compound Name | N-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-5-methoxy-3-methyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 46975099 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | N-[2-(5,6-dimethyl-1H-benzimidazol-2-yl)ethyl]-5-methoxy-3-methyl-1H-indole-2-carboxamide |
| SMILES | COc1ccc2[nH]c(C(=O)NCCc3nc4cc(C)c(C)cc4[nH]3)c(C)c2c1 |
| InChI | InChI=1S/C22H24N4O2/c1-12-9-18-19(10-13(12)2)25-20(24-18)7-8-23-22(27)21-14(3)16-11-15(28-4)5-6-17(16)26-21/h5-6,9-11,26H,7-8H2,1-4H3,(H,23,27)(H,24,25) |
| InChIKey | VZGFZWHBDZBWTK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 82.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|