C18H20N2O — CID 60979184
2-[2-(4-methoxyphenyl)ethyl]-5,6-dimethyl-1H-benzimidazole (PubChem CID 60979184) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is 2-[2-(4-methoxyphenyl)ethyl]-5,6-dimethyl-1H-benzimidazole.
| Compound Name | 2-[2-(4-methoxyphenyl)ethyl]-5,6-dimethyl-1H-benzimidazole |
|---|---|
| PubChem CID | 60979184 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 2-[2-(4-methoxyphenyl)ethyl]-5,6-dimethyl-1H-benzimidazole |
| SMILES | COc1ccc(CCc2nc3cc(C)c(C)cc3[nH]2)cc1 |
| InChI | InChI=1S/C18H20N2O/c1-12-10-16-17(11-13(12)2)20-18(19-16)9-6-14-4-7-15(21-3)8-5-14/h4-5,7-8,10-11H,6,9H2,1-3H3,(H,19,20) |
| InChIKey | HOFXKDAOAJUMBP-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |