C13H19N3 — CID 62336189
3-(5,6-dimethyl-1H-benzimidazol-2-yl)-N-methylpropan-1-amine (PubChem CID 62336189) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 3-(5,6-dimethyl-1H-benzimidazol-2-yl)-N-methylpropan-1-amine.
| Compound Name | 3-(5,6-dimethyl-1H-benzimidazol-2-yl)-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 62336189 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 3-(5,6-dimethyl-1H-benzimidazol-2-yl)-N-methylpropan-1-amine |
| SMILES | CNCCCc1nc2cc(C)c(C)cc2[nH]1 |
| InChI | InChI=1S/C13H19N3/c1-9-7-11-12(8-10(9)2)16-13(15-11)5-4-6-14-3/h7-8,14H,4-6H2,1-3H3,(H,15,16) |
| InChIKey | YAJCLROWDLHJHM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|