C12H16BrN3 — CID 104574138
3-(6-bromo-4-methyl-1H-benzimidazol-2-yl)-N-methylpropan-1-amine (PubChem CID 104574138) has the molecular formula C12H16BrN3 and a molecular weight of 282.19 g/mol. Its IUPAC name is 3-(6-bromo-4-methyl-1H-benzimidazol-2-yl)-N-methylpropan-1-amine.
| Compound Name | 3-(6-bromo-4-methyl-1H-benzimidazol-2-yl)-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 104574138 |
| Molecular Formula | C12H16BrN3 |
| Molecular Weight | 282.19 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 3-(6-bromo-4-methyl-1H-benzimidazol-2-yl)-N-methylpropan-1-amine |
| SMILES | CNCCCc1nc2c(C)cc(Br)cc2[nH]1 |
| InChI | InChI=1S/C12H16BrN3/c1-8-6-9(13)7-10-12(8)16-11(15-10)4-3-5-14-2/h6-7,14H,3-5H2,1-2H3,(H,15,16) |
| InChIKey | AOGBLVMSZUBTPL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.19 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|