C15H21BrN2 — CID 113428442
6-bromo-4-methyl-2-(2,3,3-trimethylbutyl)-1H-benzimidazole (PubChem CID 113428442) has the molecular formula C15H21BrN2 and a molecular weight of 309.25 g/mol. Its IUPAC name is 6-bromo-4-methyl-2-(2,3,3-trimethylbutyl)-1H-benzimidazole.
| Compound Name | 6-bromo-4-methyl-2-(2,3,3-trimethylbutyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 113428442 |
| Molecular Formula | C15H21BrN2 |
| Molecular Weight | 309.25 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 6-bromo-4-methyl-2-(2,3,3-trimethylbutyl)-1H-benzimidazole |
| SMILES | Cc1cc(Br)cc2[nH]c(CC(C)C(C)(C)C)nc12 |
| InChI | InChI=1S/C15H21BrN2/c1-9-6-11(16)8-12-14(9)18-13(17-12)7-10(2)15(3,4)5/h6,8,10H,7H2,1-5H3,(H,17,18) |
| InChIKey | UJKGLVMQCDCPQZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.25 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |