C16H24BrN3 — CID 104574108
3-[2-(6-bromo-4-methyl-1H-benzimidazol-2-yl)ethyl]-4-methylpentan-1-amine (PubChem CID 104574108) has the molecular formula C16H24BrN3 and a molecular weight of 338.29 g/mol. Its IUPAC name is 3-[2-(6-bromo-4-methyl-1H-benzimidazol-2-yl)ethyl]-4-methylpentan-1-amine.
| Compound Name | 3-[2-(6-bromo-4-methyl-1H-benzimidazol-2-yl)ethyl]-4-methylpentan-1-amine |
|---|---|
| PubChem CID | 104574108 |
| Molecular Formula | C16H24BrN3 |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 3-[2-(6-bromo-4-methyl-1H-benzimidazol-2-yl)ethyl]-4-methylpentan-1-amine |
| SMILES | Cc1cc(Br)cc2[nH]c(CCC(CCN)C(C)C)nc12 |
| InChI | InChI=1S/C16H24BrN3/c1-10(2)12(6-7-18)4-5-15-19-14-9-13(17)8-11(3)16(14)20-15/h8-10,12H,4-7,18H2,1-3H3,(H,19,20) |
| InChIKey | RVVSCNLDHBQERF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |