C15H21ClF3N3 — CID 144721415
4-[5-chloro-6-(trifluoromethyl)-1H-benzimidazol-2-yl]-N-methylbutan-1-amine;ethane (PubChem CID 144721415) has the molecular formula C15H21ClF3N3 and a molecular weight of 335.80 g/mol. Its IUPAC name is 4-[5-chloro-6-(trifluoromethyl)-1H-benzimidazol-2-yl]-N-methylbutan-1-amine;ethane.
| Compound Name | 4-[5-chloro-6-(trifluoromethyl)-1H-benzimidazol-2-yl]-N-methylbutan-1-amine;ethane |
|---|---|
| PubChem CID | 144721415 |
| Molecular Formula | C15H21ClF3N3 |
| Molecular Weight | 335.80 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 4-[5-chloro-6-(trifluoromethyl)-1H-benzimidazol-2-yl]-N-methylbutan-1-amine;ethane |
| SMILES | CC.CNCCCCc1nc2cc(Cl)c(C(F)(F)F)cc2[nH]1 |
| InChI | InChI=1S/C13H15ClF3N3.C2H6/c1-18-5-3-2-4-12-19-10-6-8(13(15,16)17)9(14)7-11(10)20-12;1-2/h6-7,18H,2-5H2,1H3,(H,19,20);1-2H3 |
| InChIKey | JCRRLZULOYUFKM-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.80 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|