C17H21N5O4 — CID 77089120
2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[2-(6-methoxy-1H-benzimidazol-2-yl)ethyl]acetamide (PubChem CID 77089120) has the molecular formula C17H21N5O4 and a molecular weight of 359.39 g/mol. Its IUPAC name is 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[2-(6-methoxy-1H-benzimidazol-2-yl)ethyl]acetamide.
| Compound Name | 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[2-(6-methoxy-1H-benzimidazol-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 77089120 |
| Molecular Formula | C17H21N5O4 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[2-(6-methoxy-1H-benzimidazol-2-yl)ethyl]acetamide |
| SMILES | COc1ccc2nc(CCNC(=O)CN3C(=O)NC(C)(C)C3=O)[nH]c2c1 |
| InChI | InChI=1S/C17H21N5O4/c1-17(2)15(24)22(16(25)21-17)9-14(23)18-7-6-13-19-11-5-4-10(26-3)8-12(11)20-13/h4-5,8H,6-7,9H2,1-3H3,(H,18,23)(H,19,20)(H,21,25) |
| InChIKey | SGMHZOFBZKTFEG-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 116.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|