C16H27N5 — CID 102991418
N'-[2-(6-amino-1H-benzimidazol-2-yl)ethyl]-N'-ethyl-N,N-dimethylpropane-1,3-diamine (PubChem CID 102991418) has the molecular formula C16H27N5 and a molecular weight of 289.43 g/mol. Its IUPAC name is N'-[2-(6-amino-1H-benzimidazol-2-yl)ethyl]-N'-ethyl-N,N-dimethylpropane-1,3-diamine.
| Compound Name | N'-[2-(6-amino-1H-benzimidazol-2-yl)ethyl]-N'-ethyl-N,N-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 102991418 |
| Molecular Formula | C16H27N5 |
| Molecular Weight | 289.43 g/mol |
| Exact Mass | 289.23 |
| IUPAC Name | N'-[2-(6-amino-1H-benzimidazol-2-yl)ethyl]-N'-ethyl-N,N-dimethylpropane-1,3-diamine |
| SMILES | CCN(CCCN(C)C)CCc1nc2ccc(N)cc2[nH]1 |
| InChI | InChI=1S/C16H27N5/c1-4-21(10-5-9-20(2)3)11-8-16-18-14-7-6-13(17)12-15(14)19-16/h6-7,12H,4-5,8-11,17H2,1-3H3,(H,18,19) |
| InChIKey | BCMJZWQTUDSOGI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 61.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.43 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|