C17H21N5O3 — CID 91766350
2-(2,5-dioxoimidazolidin-1-yl)-N-ethyl-N-[2-(6-methyl-1H-benzimidazol-2-yl)ethyl]acetamide (PubChem CID 91766350) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is 2-(2,5-dioxoimidazolidin-1-yl)-N-ethyl-N-[2-(6-methyl-1H-benzimidazol-2-yl)ethyl]acetamide.
| Compound Name | 2-(2,5-dioxoimidazolidin-1-yl)-N-ethyl-N-[2-(6-methyl-1H-benzimidazol-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 91766350 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 2-(2,5-dioxoimidazolidin-1-yl)-N-ethyl-N-[2-(6-methyl-1H-benzimidazol-2-yl)ethyl]acetamide |
| SMILES | CCN(CCc1nc2ccc(C)cc2[nH]1)C(=O)CN1C(=O)CNC1=O |
| InChI | InChI=1S/C17H21N5O3/c1-3-21(16(24)10-22-15(23)9-18-17(22)25)7-6-14-19-12-5-4-11(2)8-13(12)20-14/h4-5,8H,3,6-7,9-10H2,1-2H3,(H,18,25)(H,19,20) |
| InChIKey | UDIXXGKYNGHTLK-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 98.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|