C15H22N4O — CID 91831683
N-ethyl-3-[methyl-[(6-methyl-1H-benzimidazol-2-yl)methyl]amino]propanamide (PubChem CID 91831683) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is N-ethyl-3-[methyl-[(6-methyl-1H-benzimidazol-2-yl)methyl]amino]propanamide.
| Compound Name | N-ethyl-3-[methyl-[(6-methyl-1H-benzimidazol-2-yl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 91831683 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | N-ethyl-3-[methyl-[(6-methyl-1H-benzimidazol-2-yl)methyl]amino]propanamide |
| SMILES | CCNC(=O)CCN(C)Cc1nc2ccc(C)cc2[nH]1 |
| InChI | InChI=1S/C15H22N4O/c1-4-16-15(20)7-8-19(3)10-14-17-12-6-5-11(2)9-13(12)18-14/h5-6,9H,4,7-8,10H2,1-3H3,(H,16,20)(H,17,18) |
| InChIKey | IQAHDKGYHOILPZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |