C13H18ClN3 — CID 82335889
N-[(6-chloro-1H-benzimidazol-2-yl)methyl]-N-methylbutan-1-amine (PubChem CID 82335889) has the molecular formula C13H18ClN3 and a molecular weight of 251.76 g/mol. Its IUPAC name is N-[(6-chloro-1H-benzimidazol-2-yl)methyl]-N-methylbutan-1-amine.
| Compound Name | N-[(6-chloro-1H-benzimidazol-2-yl)methyl]-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 82335889 |
| Molecular Formula | C13H18ClN3 |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | N-[(6-chloro-1H-benzimidazol-2-yl)methyl]-N-methylbutan-1-amine |
| SMILES | CCCCN(C)Cc1nc2ccc(Cl)cc2[nH]1 |
| InChI | InChI=1S/C13H18ClN3/c1-3-4-7-17(2)9-13-15-11-6-5-10(14)8-12(11)16-13/h5-6,8H,3-4,7,9H2,1-2H3,(H,15,16) |
| InChIKey | FHCRNAUYQXFVAO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |