C11H14ClN3O2S — CID 131946800
N-[(6-chloro-1H-benzimidazol-2-yl)methyl]-N-methylethanesulfonamide (PubChem CID 131946800) has the molecular formula C11H14ClN3O2S and a molecular weight of 287.77 g/mol. Its IUPAC name is N-[(6-chloro-1H-benzimidazol-2-yl)methyl]-N-methylethanesulfonamide.
| Compound Name | N-[(6-chloro-1H-benzimidazol-2-yl)methyl]-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 131946800 |
| Molecular Formula | C11H14ClN3O2S |
| Molecular Weight | 287.77 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | N-[(6-chloro-1H-benzimidazol-2-yl)methyl]-N-methylethanesulfonamide |
| SMILES | CCS(=O)(=O)N(C)Cc1nc2ccc(Cl)cc2[nH]1 |
| InChI | InChI=1S/C11H14ClN3O2S/c1-3-18(16,17)15(2)7-11-13-9-5-4-8(12)6-10(9)14-11/h4-6H,3,7H2,1-2H3,(H,13,14) |
| InChIKey | GWXZKWVOAYBWOY-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.77 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |