C15H13Cl2N3O2S — CID 35385421
N-(1H-benzimidazol-2-ylmethyl)-3,5-dichloro-N-methylbenzenesulfonamide (PubChem CID 35385421) has the molecular formula C15H13Cl2N3O2S and a molecular weight of 370.26 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-ylmethyl)-3,5-dichloro-N-methylbenzenesulfonamide.
| Compound Name | N-(1H-benzimidazol-2-ylmethyl)-3,5-dichloro-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 35385421 |
| Molecular Formula | C15H13Cl2N3O2S |
| Molecular Weight | 370.26 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | N-(1H-benzimidazol-2-ylmethyl)-3,5-dichloro-N-methylbenzenesulfonamide |
| SMILES | CN(Cc1nc2ccccc2[nH]1)S(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C15H13Cl2N3O2S/c1-20(9-15-18-13-4-2-3-5-14(13)19-15)23(21,22)12-7-10(16)6-11(17)8-12/h2-8H,9H2,1H3,(H,18,19) |
| InChIKey | VIWZIJULLUDSLH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.26 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |