C22H21N3O3S — CID 162668375
N-(1H-benzimidazol-2-ylmethyl)-N-(4-methoxyphenyl)-4-methylbenzenesulfonamide (PubChem CID 162668375) has the molecular formula C22H21N3O3S and a molecular weight of 407.50 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-ylmethyl)-N-(4-methoxyphenyl)-4-methylbenzenesulfonamide.
| Compound Name | N-(1H-benzimidazol-2-ylmethyl)-N-(4-methoxyphenyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 162668375 |
| Molecular Formula | C22H21N3O3S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | N-(1H-benzimidazol-2-ylmethyl)-N-(4-methoxyphenyl)-4-methylbenzenesulfonamide |
| SMILES | COc1ccc(N(Cc2nc3ccccc3[nH]2)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C22H21N3O3S/c1-16-7-13-19(14-8-16)29(26,27)25(17-9-11-18(28-2)12-10-17)15-22-23-20-5-3-4-6-21(20)24-22/h3-14H,15H2,1-2H3,(H,23,24) |
| InChIKey | GFBGWCDSSPBDKT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |