C13H18N4O3S2 — CID 126823525
2-[[methyl-[(1-oxothiolan-1-ylidene)amino]sulfonylamino]methyl]-1H-benzimidazole (PubChem CID 126823525) has the molecular formula C13H18N4O3S2 and a molecular weight of 342.45 g/mol. Its IUPAC name is 2-[[methyl-[(1-oxothiolan-1-ylidene)amino]sulfonylamino]methyl]-1H-benzimidazole.
| Compound Name | 2-[[methyl-[(1-oxothiolan-1-ylidene)amino]sulfonylamino]methyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 126823525 |
| Molecular Formula | C13H18N4O3S2 |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 2-[[methyl-[(1-oxothiolan-1-ylidene)amino]sulfonylamino]methyl]-1H-benzimidazole |
| SMILES | CN(Cc1nc2ccccc2[nH]1)S(=O)(=O)N=S1(=O)CCCC1 |
| InChI | InChI=1S/C13H18N4O3S2/c1-17(22(19,20)16-21(18)8-4-5-9-21)10-13-14-11-6-2-3-7-12(11)15-13/h2-3,6-7H,4-5,8-10H2,1H3,(H,14,15) |
| InChIKey | OHLVMEGHZPQJAR-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 95.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |