C15H22N4O2S — CID 35385286
(3R)-N-(1H-benzimidazol-2-ylmethyl)-N,3-dimethylpiperidine-1-sulfonamide (PubChem CID 35385286) has the molecular formula C15H22N4O2S and a molecular weight of 322.43 g/mol. Its IUPAC name is (3R)-N-(1H-benzimidazol-2-ylmethyl)-N,3-dimethylpiperidine-1-sulfonamide.
| Compound Name | (3R)-N-(1H-benzimidazol-2-ylmethyl)-N,3-dimethylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 35385286 |
| Molecular Formula | C15H22N4O2S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | (3R)-N-(1H-benzimidazol-2-ylmethyl)-N,3-dimethylpiperidine-1-sulfonamide |
| SMILES | C[C@@H]1CCCN(S(=O)(=O)N(C)Cc2nc3ccccc3[nH]2)C1 |
| InChI | InChI=1S/C15H22N4O2S/c1-12-6-5-9-19(10-12)22(20,21)18(2)11-15-16-13-7-3-4-8-14(13)17-15/h3-4,7-8,12H,5-6,9-11H2,1-2H3,(H,16,17)/t12-/m1/s1 |
| InChIKey | ZTTRKJZAVMDSDY-GFCCVEGCSA-N |
| XLogP | 1.97 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |