C19H28N4O2S — CID 46980652
2-[[1-(4-methylpiperidin-1-yl)sulfonylpiperidin-3-yl]methyl]-1H-benzimidazole (PubChem CID 46980652) has the molecular formula C19H28N4O2S and a molecular weight of 376.53 g/mol. Its IUPAC name is 2-[[1-(4-methylpiperidin-1-yl)sulfonylpiperidin-3-yl]methyl]-1H-benzimidazole.
| Compound Name | 2-[[1-(4-methylpiperidin-1-yl)sulfonylpiperidin-3-yl]methyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 46980652 |
| Molecular Formula | C19H28N4O2S |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 2-[[1-(4-methylpiperidin-1-yl)sulfonylpiperidin-3-yl]methyl]-1H-benzimidazole |
| SMILES | CC1CCN(S(=O)(=O)N2CCCC(Cc3nc4ccccc4[nH]3)C2)CC1 |
| InChI | InChI=1S/C19H28N4O2S/c1-15-8-11-22(12-9-15)26(24,25)23-10-4-5-16(14-23)13-19-20-17-6-2-3-7-18(17)21-19/h2-3,6-7,15-16H,4-5,8-14H2,1H3,(H,20,21) |
| InChIKey | KOCSXEHMGKNMBB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |