C18H21N5 — CID 72917014
2-[[1-(6-methylpyridazin-3-yl)piperidin-3-yl]methyl]-1H-benzimidazole (PubChem CID 72917014) has the molecular formula C18H21N5 and a molecular weight of 307.40 g/mol. Its IUPAC name is 2-[[1-(6-methylpyridazin-3-yl)piperidin-3-yl]methyl]-1H-benzimidazole.
| Compound Name | 2-[[1-(6-methylpyridazin-3-yl)piperidin-3-yl]methyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 72917014 |
| Molecular Formula | C18H21N5 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 2-[[1-(6-methylpyridazin-3-yl)piperidin-3-yl]methyl]-1H-benzimidazole |
| SMILES | Cc1ccc(N2CCCC(Cc3nc4ccccc4[nH]3)C2)nn1 |
| InChI | InChI=1S/C18H21N5/c1-13-8-9-18(22-21-13)23-10-4-5-14(12-23)11-17-19-15-6-2-3-7-16(15)20-17/h2-3,6-9,14H,4-5,10-12H2,1H3,(H,19,20) |
| InChIKey | AIXAAQRPGPTMSH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |