C20H28N4O4S — CID 25330284
ethyl (3S)-1-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]sulfonylpiperidine-3-carboxylate (PubChem CID 25330284) has the molecular formula C20H28N4O4S and a molecular weight of 420.54 g/mol. Its IUPAC name is ethyl (3S)-1-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]sulfonylpiperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]sulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 25330284 |
| Molecular Formula | C20H28N4O4S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | ethyl (3S)-1-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]sulfonylpiperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN(S(=O)(=O)N2CCC(c3nc4ccccc4[nH]3)CC2)C1 |
| InChI | InChI=1S/C20H28N4O4S/c1-2-28-20(25)16-6-5-11-24(14-16)29(26,27)23-12-9-15(10-13-23)19-21-17-7-3-4-8-18(17)22-19/h3-4,7-8,15-16H,2,5-6,9-14H2,1H3,(H,21,22)/t16-/m0/s1 |
| InChIKey | SZVXWUYVSIFYMC-INIZCTEOSA-N |
| XLogP | 2.26 |
| TPSA | 95.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |