C14H12ClN5O2 — CID 134703059
6-[(6-chloro-1H-benzimidazol-2-yl)methyl-methylamino]pyrazine-2-carboxylic acid (PubChem CID 134703059) has the molecular formula C14H12ClN5O2 and a molecular weight of 317.74 g/mol. Its IUPAC name is 6-[(6-chloro-1H-benzimidazol-2-yl)methyl-methylamino]pyrazine-2-carboxylic acid.
| Compound Name | 6-[(6-chloro-1H-benzimidazol-2-yl)methyl-methylamino]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 134703059 |
| Molecular Formula | C14H12ClN5O2 |
| Molecular Weight | 317.74 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 6-[(6-chloro-1H-benzimidazol-2-yl)methyl-methylamino]pyrazine-2-carboxylic acid |
| SMILES | CN(Cc1nc2ccc(Cl)cc2[nH]1)c1cncc(C(=O)O)n1 |
| InChI | InChI=1S/C14H12ClN5O2/c1-20(13-6-16-5-11(19-13)14(21)22)7-12-17-9-3-2-8(15)4-10(9)18-12/h2-6H,7H2,1H3,(H,17,18)(H,21,22) |
| InChIKey | RWIKRWDHYKNWKH-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.74 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |