C22H20ClN3O2S — CID 24758473
N-[2-[2-[2-(4-chlorophenyl)ethyl]-3H-benzimidazol-5-yl]phenyl]methanesulfonamide (PubChem CID 24758473) has the molecular formula C22H20ClN3O2S and a molecular weight of 425.94 g/mol. Its IUPAC name is N-[2-[2-[2-(4-chlorophenyl)ethyl]-3H-benzimidazol-5-yl]phenyl]methanesulfonamide.
| Compound Name | N-[2-[2-[2-(4-chlorophenyl)ethyl]-3H-benzimidazol-5-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 24758473 |
| Molecular Formula | C22H20ClN3O2S |
| Molecular Weight | 425.94 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | N-[2-[2-[2-(4-chlorophenyl)ethyl]-3H-benzimidazol-5-yl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccccc1-c1ccc2nc(CCc3ccc(Cl)cc3)[nH]c2c1 |
| InChI | InChI=1S/C22H20ClN3O2S/c1-29(27,28)26-19-5-3-2-4-18(19)16-9-12-20-21(14-16)25-22(24-20)13-8-15-6-10-17(23)11-7-15/h2-7,9-12,14,26H,8,13H2,1H3,(H,24,25) |
| InChIKey | WDMCUOVVNZAHRD-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.94 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |