C15H20N6 — CID 61438668
2-[2-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]ethyl]-3H-benzimidazol-5-amine (PubChem CID 61438668) has the molecular formula C15H20N6 and a molecular weight of 284.37 g/mol. Its IUPAC name is 2-[2-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]ethyl]-3H-benzimidazol-5-amine.
| Compound Name | 2-[2-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]ethyl]-3H-benzimidazol-5-amine |
|---|---|
| PubChem CID | 61438668 |
| Molecular Formula | C15H20N6 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 2-[2-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]ethyl]-3H-benzimidazol-5-amine |
| SMILES | CN(CCc1nc2ccc(N)cc2[nH]1)Cc1cnn(C)c1 |
| InChI | InChI=1S/C15H20N6/c1-20(9-11-8-17-21(2)10-11)6-5-15-18-13-4-3-12(16)7-14(13)19-15/h3-4,7-8,10H,5-6,9,16H2,1-2H3,(H,18,19) |
| InChIKey | BXGOQWVCFBSGEL-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|