C11H11N5O — CID 116792483
2-(1-methylpyrazol-4-yl)oxy-3H-benzimidazol-5-amine (PubChem CID 116792483) has the molecular formula C11H11N5O and a molecular weight of 229.24 g/mol. Its IUPAC name is 2-(1-methylpyrazol-4-yl)oxy-3H-benzimidazol-5-amine.
| Compound Name | 2-(1-methylpyrazol-4-yl)oxy-3H-benzimidazol-5-amine |
|---|---|
| PubChem CID | 116792483 |
| Molecular Formula | C11H11N5O |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 2-(1-methylpyrazol-4-yl)oxy-3H-benzimidazol-5-amine |
| SMILES | Cn1cc(Oc2nc3ccc(N)cc3[nH]2)cn1 |
| InChI | InChI=1S/C11H11N5O/c1-16-6-8(5-13-16)17-11-14-9-3-2-7(12)4-10(9)15-11/h2-6H,12H2,1H3,(H,14,15) |
| InChIKey | FKVSEOOKZXLTEO-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|