C17H21FN6O — CID 122566230
1-[(6-fluoro-1H-benzimidazol-2-yl)methyl]-1-methyl-3-[3-(1-methylpyrazol-4-yl)propyl]urea (PubChem CID 122566230) has the molecular formula C17H21FN6O and a molecular weight of 344.39 g/mol. Its IUPAC name is 1-[(6-fluoro-1H-benzimidazol-2-yl)methyl]-1-methyl-3-[3-(1-methylpyrazol-4-yl)propyl]urea.
| Compound Name | 1-[(6-fluoro-1H-benzimidazol-2-yl)methyl]-1-methyl-3-[3-(1-methylpyrazol-4-yl)propyl]urea |
|---|---|
| PubChem CID | 122566230 |
| Molecular Formula | C17H21FN6O |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 1-[(6-fluoro-1H-benzimidazol-2-yl)methyl]-1-methyl-3-[3-(1-methylpyrazol-4-yl)propyl]urea |
| SMILES | CN(Cc1nc2ccc(F)cc2[nH]1)C(=O)NCCCc1cnn(C)c1 |
| InChI | InChI=1S/C17H21FN6O/c1-23(11-16-21-14-6-5-13(18)8-15(14)22-16)17(25)19-7-3-4-12-9-20-24(2)10-12/h5-6,8-10H,3-4,7,11H2,1-2H3,(H,19,25)(H,21,22) |
| InChIKey | CIUFLJQJJCJVST-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|