C8H6ClN3O — CID 137264750
2-(chloromethyl)-3H-pyrido[3,2-d]pyrimidin-4-one (PubChem CID 137264750) has the molecular formula C8H6ClN3O and a molecular weight of 195.61 g/mol. Its IUPAC name is 2-(chloromethyl)-3H-pyrido[3,2-d]pyrimidin-4-one.
| Compound Name | 2-(chloromethyl)-3H-pyrido[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137264750 |
| Molecular Formula | C8H6ClN3O |
| Molecular Weight | 195.61 g/mol |
| Exact Mass | 195.02 |
| IUPAC Name | 2-(chloromethyl)-3H-pyrido[3,2-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(CCl)nc2cccnc12 |
| InChI | InChI=1S/C8H6ClN3O/c9-4-6-11-5-2-1-3-10-7(5)8(13)12-6/h1-3H,4H2,(H,11,12,13) |
| InChIKey | WDWWEGMXUGUMKL-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.61 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|