C14H16N2O4 — CID 84642221
2-(dimethylamino)-6,7-dimethoxyquinoline-4-carboxylic acid (PubChem CID 84642221) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is 2-(dimethylamino)-6,7-dimethoxyquinoline-4-carboxylic acid.
| Compound Name | 2-(dimethylamino)-6,7-dimethoxyquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 84642221 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 2-(dimethylamino)-6,7-dimethoxyquinoline-4-carboxylic acid |
| SMILES | COc1cc2nc(N(C)C)cc(C(=O)O)c2cc1OC |
| InChI | InChI=1S/C14H16N2O4/c1-16(2)13-6-9(14(17)18)8-5-11(19-3)12(20-4)7-10(8)15-13/h5-7H,1-4H3,(H,17,18) |
| InChIKey | ZKKSYDYABHHJBM-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |