C28H25N3O3S — CID 140999561
N-[1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]-3-(naphthalen-2-ylsulfinylamino)benzamide (PubChem CID 140999561) has the molecular formula C28H25N3O3S and a molecular weight of 483.59 g/mol. Its IUPAC name is N-[1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]-3-(naphthalen-2-ylsulfinylamino)benzamide.
| Compound Name | N-[1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]-3-(naphthalen-2-ylsulfinylamino)benzamide |
|---|---|
| PubChem CID | 140999561 |
| Molecular Formula | C28H25N3O3S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | N-[1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]-3-(naphthalen-2-ylsulfinylamino)benzamide |
| SMILES | O=C(NC(CO)Cc1c[nH]c2ccccc12)c1cccc(NS(=O)c2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C28H25N3O3S/c32-18-24(15-22-17-29-27-11-4-3-10-26(22)27)30-28(33)21-8-5-9-23(14-21)31-35(34)25-13-12-19-6-1-2-7-20(19)16-25/h1-14,16-17,24,29,31-32H,15,18H2,(H,30,33) |
| InChIKey | FSIFOYIVGIRDMZ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |