C29H37N3O4 — CID 57454806
5-[3-[[(2R,3R)-3-hydroxybutan-2-yl]-methylamino]prop-1-ynyl]-N-[(2R)-1-hydroxy-2-(1H-indol-3-yl)propyl]-2-propan-2-yloxybenzamide (PubChem CID 57454806) has the molecular formula C29H37N3O4 and a molecular weight of 491.63 g/mol. Its IUPAC name is 5-[3-[[(2R,3R)-3-hydroxybutan-2-yl]-methylamino]prop-1-ynyl]-N-[(2R)-1-hydroxy-2-(1H-indol-3-yl)propyl]-2-propan-2-yloxybenzamide.
| Compound Name | 5-[3-[[(2R,3R)-3-hydroxybutan-2-yl]-methylamino]prop-1-ynyl]-N-[(2R)-1-hydroxy-2-(1H-indol-3-yl)propyl]-2-propan-2-yloxybenzamide |
|---|---|
| PubChem CID | 57454806 |
| Molecular Formula | C29H37N3O4 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.28 |
| IUPAC Name | 5-[3-[[(2R,3R)-3-hydroxybutan-2-yl]-methylamino]prop-1-ynyl]-N-[(2R)-1-hydroxy-2-(1H-indol-3-yl)propyl]-2-propan-2-yloxybenzamide |
| SMILES | CC(C)Oc1ccc(C#CCN(C)[C@H](C)[C@@H](C)O)cc1C(=O)NC(O)[C@H](C)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C29H37N3O4/c1-18(2)36-27-14-13-22(10-9-15-32(6)20(4)21(5)33)16-24(27)29(35)31-28(34)19(3)25-17-30-26-12-8-7-11-23(25)26/h7-8,11-14,16-21,28,30,33-34H,15H2,1-6H3,(H,31,35)/t19-,20-,21-,28?/m1/s1 |
| InChIKey | CEEGTWWVWGJGKN-PESDJSCESA-N |
| XLogP | 3.86 |
| TPSA | 97.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|