C29H26N2O4 — CID 71090469
5-[2-(1,3-benzodioxol-5-yl)ethynyl]-N-[2-(1H-indol-3-yl)ethyl]-2-propan-2-yloxybenzamide (PubChem CID 71090469) has the molecular formula C29H26N2O4 and a molecular weight of 466.54 g/mol. Its IUPAC name is 5-[2-(1,3-benzodioxol-5-yl)ethynyl]-N-[2-(1H-indol-3-yl)ethyl]-2-propan-2-yloxybenzamide.
| Compound Name | 5-[2-(1,3-benzodioxol-5-yl)ethynyl]-N-[2-(1H-indol-3-yl)ethyl]-2-propan-2-yloxybenzamide |
|---|---|
| PubChem CID | 71090469 |
| Molecular Formula | C29H26N2O4 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 5-[2-(1,3-benzodioxol-5-yl)ethynyl]-N-[2-(1H-indol-3-yl)ethyl]-2-propan-2-yloxybenzamide |
| SMILES | CC(C)Oc1ccc(C#Cc2ccc3c(c2)OCO3)cc1C(=O)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C29H26N2O4/c1-19(2)35-26-11-9-20(7-8-21-10-12-27-28(16-21)34-18-33-27)15-24(26)29(32)30-14-13-22-17-31-25-6-4-3-5-23(22)25/h3-6,9-12,15-17,19,31H,13-14,18H2,1-2H3,(H,30,32) |
| InChIKey | CEUIDNSRCVOTTP-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|