C32H32N4O3 — CID 143753668
N-[1-cyano-3-(1H-indol-3-yl)propan-2-yl]-5-[2-(4-formylphenyl)ethynyl]-2-propan-2-yloxybenzamide;methanamine (PubChem CID 143753668) has the molecular formula C32H32N4O3 and a molecular weight of 520.63 g/mol. Its IUPAC name is N-[1-cyano-3-(1H-indol-3-yl)propan-2-yl]-5-[2-(4-formylphenyl)ethynyl]-2-propan-2-yloxybenzamide;methanamine.
| Compound Name | N-[1-cyano-3-(1H-indol-3-yl)propan-2-yl]-5-[2-(4-formylphenyl)ethynyl]-2-propan-2-yloxybenzamide;methanamine |
|---|---|
| PubChem CID | 143753668 |
| Molecular Formula | C32H32N4O3 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | N-[1-cyano-3-(1H-indol-3-yl)propan-2-yl]-5-[2-(4-formylphenyl)ethynyl]-2-propan-2-yloxybenzamide;methanamine |
| SMILES | CC(C)Oc1ccc(C#Cc2ccc(C=O)cc2)cc1C(=O)NC(CC#N)Cc1c[nH]c2ccccc12.CN |
| InChI | InChI=1S/C31H27N3O3.CH5N/c1-21(2)37-30-14-13-23(10-7-22-8-11-24(20-35)12-9-22)17-28(30)31(36)34-26(15-16-32)18-25-19-33-29-6-4-3-5-27(25)29;1-2/h3-6,8-9,11-14,17,19-21,26,33H,15,18H2,1-2H3,(H,34,36);2H2,1H3 |
| InChIKey | QVFJGYRLAZAWGW-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 121.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|