C21H23IN2O3 — CID 69332033
N-[(2R)-1-hydroxy-2-(1H-indol-3-yl)propyl]-5-iodo-2-propoxybenzamide (PubChem CID 69332033) has the molecular formula C21H23IN2O3 and a molecular weight of 478.33 g/mol. Its IUPAC name is N-[(2R)-1-hydroxy-2-(1H-indol-3-yl)propyl]-5-iodo-2-propoxybenzamide.
| Compound Name | N-[(2R)-1-hydroxy-2-(1H-indol-3-yl)propyl]-5-iodo-2-propoxybenzamide |
|---|---|
| PubChem CID | 69332033 |
| Molecular Formula | C21H23IN2O3 |
| Molecular Weight | 478.33 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | N-[(2R)-1-hydroxy-2-(1H-indol-3-yl)propyl]-5-iodo-2-propoxybenzamide |
| SMILES | CCCOc1ccc(I)cc1C(=O)NC(O)[C@H](C)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C21H23IN2O3/c1-3-10-27-19-9-8-14(22)11-16(19)21(26)24-20(25)13(2)17-12-23-18-7-5-4-6-15(17)18/h4-9,11-13,20,23,25H,3,10H2,1-2H3,(H,24,26)/t13-,20?/m1/s1 |
| InChIKey | PSWXRFUMYMIPOB-CRIUFTBBSA-N |
| XLogP | 4.41 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.33 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|