C23H35NO6S — CID 70163083
2-amino-1-(5-dodec-1-ynylthiophen-3-yl)propane-1,3-diol;(Z)-but-2-enedioic acid (PubChem CID 70163083) has the molecular formula C23H35NO6S and a molecular weight of 453.60 g/mol. Its IUPAC name is 2-amino-1-(5-dodec-1-ynylthiophen-3-yl)propane-1,3-diol;(Z)-but-2-enedioic acid.
| Compound Name | 2-amino-1-(5-dodec-1-ynylthiophen-3-yl)propane-1,3-diol;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 70163083 |
| Molecular Formula | C23H35NO6S |
| Molecular Weight | 453.60 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | 2-amino-1-(5-dodec-1-ynylthiophen-3-yl)propane-1,3-diol;(Z)-but-2-enedioic acid |
| SMILES | CCCCCCCCCCC#Cc1cc(C(O)C(N)CO)cs1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C19H31NO2S.C4H4O4/c1-2-3-4-5-6-7-8-9-10-11-12-17-13-16(15-23-17)19(22)18(20)14-21;5-3(6)1-2-4(7)8/h13,15,18-19,21-22H,2-10,14,20H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | QWWKCTDRLDEODF-BTJKTKAUSA-N |
| XLogP | 3.70 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.60 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|